C22H29F3N2O4 — CID 162903937
2-[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 162903937) has the molecular formula C22H29F3N2O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 2-[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 162903937 |
| Molecular Formula | C22H29F3N2O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-[5-[[(4,4-difluorocyclohexyl)amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CC1CC2OC(CNC3CCC(F)(F)CC3)C(O)C2O1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H29F3N2O4/c23-14-3-1-13(2-4-14)11-27-19(28)10-16-9-17-21(30-16)20(29)18(31-17)12-26-15-5-7-22(24,25)8-6-15/h1-4,15-18,20-21,26,29H,5-12H2,(H,27,28) |
| InChIKey | LCTNLIBORYHABU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |