C19H27ClN2O4 — CID 162793220
2-[5-[[(2-chlorophenyl)methylamino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propan-2-ylacetamide (PubChem CID 162793220) has the molecular formula C19H27ClN2O4 and a molecular weight of 382.89 g/mol. Its IUPAC name is 2-[5-[[(2-chlorophenyl)methylamino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[5-[[(2-chlorophenyl)methylamino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 162793220 |
| Molecular Formula | C19H27ClN2O4 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2-[5-[[(2-chlorophenyl)methylamino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CC1CC2OC(CNCc3ccccc3Cl)C(O)C2O1 |
| InChI | InChI=1S/C19H27ClN2O4/c1-11(2)22-17(23)8-13-7-15-19(25-13)18(24)16(26-15)10-21-9-12-5-3-4-6-14(12)20/h3-6,11,13,15-16,18-19,21,24H,7-10H2,1-2H3,(H,22,23) |
| InChIKey | OQCRUCZANAQQKC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |