C17H30N2O5 — CID 162792886
2-[6-hydroxy-5-[(oxan-4-ylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propan-2-ylacetamide (PubChem CID 162792886) has the molecular formula C17H30N2O5 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[6-hydroxy-5-[(oxan-4-ylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[6-hydroxy-5-[(oxan-4-ylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 162792886 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 2-[6-hydroxy-5-[(oxan-4-ylamino)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CC1CC2OC(CNC3CCOCC3)C(O)C2O1 |
| InChI | InChI=1S/C17H30N2O5/c1-10(2)19-15(20)8-12-7-13-17(23-12)16(21)14(24-13)9-18-11-3-5-22-6-4-11/h10-14,16-18,21H,3-9H2,1-2H3,(H,19,20) |
| InChIKey | YJYRKKFRBZCGQC-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |