C16H17ClFN3O5 — CID 53325965
1-[(2R,3R,4S,5R)-5-[[(2-chlorophenyl)methylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 53325965) has the molecular formula C16H17ClFN3O5 and a molecular weight of 385.78 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-[[(2-chlorophenyl)methylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-[[(2-chlorophenyl)methylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 53325965 |
| Molecular Formula | C16H17ClFN3O5 |
| Molecular Weight | 385.78 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-[[(2-chlorophenyl)methylamino]methyl]-3,4-dihydroxyoxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CNCc3ccccc3Cl)[C@@H](O)[C@H]2O)cc1F |
| InChI | InChI=1S/C16H17ClFN3O5/c17-9-4-2-1-3-8(9)5-19-6-11-12(22)13(23)15(26-11)21-7-10(18)14(24)20-16(21)25/h1-4,7,11-13,15,19,22-23H,5-6H2,(H,20,24,25)/t11-,12-,13-,15-/m1/s1 |
| InChIKey | NMIPUPLWOJRPEW-RGCMKSIDSA-N |
| XLogP | -0.26 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.78 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |