C14H15N5O2S2 — CID 100664521
5-propan-2-ylsulfanyl-2-quinolin-8-ylsulfonyl-1,2,4-triazol-3-amine (PubChem CID 100664521) has the molecular formula C14H15N5O2S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 5-propan-2-ylsulfanyl-2-quinolin-8-ylsulfonyl-1,2,4-triazol-3-amine.
| Compound Name | 5-propan-2-ylsulfanyl-2-quinolin-8-ylsulfonyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 100664521 |
| Molecular Formula | C14H15N5O2S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 5-propan-2-ylsulfanyl-2-quinolin-8-ylsulfonyl-1,2,4-triazol-3-amine |
| SMILES | CC(C)Sc1nc(N)n(S(=O)(=O)c2cccc3cccnc23)n1 |
| InChI | InChI=1S/C14H15N5O2S2/c1-9(2)22-14-17-13(15)19(18-14)23(20,21)11-7-3-5-10-6-4-8-16-12(10)11/h3-9H,1-2H3,(H2,15,17,18) |
| InChIKey | QDCQTGAADZCCSD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |