C18H20N4O3 — CID 100667472
[(3R)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl 4-aminopyrimidine-5-carboxylate (PubChem CID 100667472) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is [(3R)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl 4-aminopyrimidine-5-carboxylate.
| Compound Name | [(3R)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl 4-aminopyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 100667472 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [(3R)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl 4-aminopyrimidine-5-carboxylate |
| SMILES | Nc1ncncc1C(=O)OC[C@@H]1CC(=O)N(CCc2ccccc2)C1 |
| InChI | InChI=1S/C18H20N4O3/c19-17-15(9-20-12-21-17)18(24)25-11-14-8-16(23)22(10-14)7-6-13-4-2-1-3-5-13/h1-5,9,12,14H,6-8,10-11H2,(H2,19,20,21)/t14-/m1/s1 |
| InChIKey | DHZDLDKHWKXXQB-CQSZACIVSA-N |
| XLogP | 1.31 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |