About [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate
[(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate (PubChem CID 97082060) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate |
| PubChem CID | 97082060 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate |
| SMILES | O=C(OC[C@H]1CC(=O)N(CCc2ccccc2)C1)c1cccnc1 |
| InChI | InChI=1S/C19H20N2O3/c22-18-11-16(14-24-19(23)17-7-4-9-20-12-17)13-21(18)10-8-15-5-2-1-3-6-15/h1-7,9,12,16H,8,10-11,13-14H2/t16-/m0/s1 |
| InChIKey | DZXSHJBFKMWPFR-INIZCTEOSA-N |
| XLogP | 2.33 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate?
The IUPAC name of [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate (CID 97082060) is [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate.
What is the SMILES notation for [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate?
The canonical SMILES for [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate is O=C(OC[C@H]1CC(=O)N(CCc2ccccc2)C1)c1cccnc1.
What is the InChIKey of [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate?
The InChIKey is DZXSHJBFKMWPFR-INIZCTEOSA-N. The full InChI is InChI=1S/C19H20N2O3/c22-18-11-16(14-24-19(23)17-7-4-9-20-12-17)13-21(18)10-8-15-5-2-1-3-6-15/h1-7,9,12,16H,8,10-11,13-14H2/t16-/m0/s1.
What are the key properties of [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate?
[(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate has a molecular weight of 324.38 g/mol, XLogP of 2.33, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl pyridine-3-carboxylate is sourced from PubChem (CID 97082060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).