About (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate
(1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate (PubChem CID 166243406) has the molecular formula C20H18N2O3S
and a molecular weight of 366.44 g/mol. Its IUPAC name is (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate.
Molecular Properties
| Compound Name | (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate |
| PubChem CID | 166243406 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate |
| SMILES | O=C(OCC1CC(=O)N(Cc2ccccc2)C1)c1cncc2sccc12 |
| InChI | InChI=1S/C20H18N2O3S/c23-19-8-15(12-22(19)11-14-4-2-1-3-5-14)13-25-20(24)17-9-21-10-18-16(17)6-7-26-18/h1-7,9-10,15H,8,11-13H2 |
| InChIKey | VROYQCOPCVQDQH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate?
The IUPAC name of (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate (CID 166243406) is (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate.
What is the SMILES notation for (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate?
The canonical SMILES for (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate is O=C(OCC1CC(=O)N(Cc2ccccc2)C1)c1cncc2sccc12.
What is the InChIKey of (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate?
The InChIKey is VROYQCOPCVQDQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3S/c23-19-8-15(12-22(19)11-14-4-2-1-3-5-14)13-25-20(24)17-9-21-10-18-16(17)6-7-26-18/h1-7,9-10,15H,8,11-13H2.
What are the key properties of (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate?
(1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate has a molecular weight of 366.44 g/mol, XLogP of 3.50, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzyl-5-oxopyrrolidin-3-yl)methyl thieno[2,3-c]pyridine-4-carboxylate is sourced from PubChem (CID 166243406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).