C22H21ClN4O3 — CID 172880568
(1-benzyl-5-oxopyrrolidin-3-yl)methyl 1-(3-chlorophenyl)-5-methyltriazole-4-carboxylate (PubChem CID 172880568) has the molecular formula C22H21ClN4O3 and a molecular weight of 424.89 g/mol. Its IUPAC name is (1-benzyl-5-oxopyrrolidin-3-yl)methyl 1-(3-chlorophenyl)-5-methyltriazole-4-carboxylate.
| Compound Name | (1-benzyl-5-oxopyrrolidin-3-yl)methyl 1-(3-chlorophenyl)-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 172880568 |
| Molecular Formula | C22H21ClN4O3 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (1-benzyl-5-oxopyrrolidin-3-yl)methyl 1-(3-chlorophenyl)-5-methyltriazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OCC2CC(=O)N(Cc3ccccc3)C2)nnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H21ClN4O3/c1-15-21(24-25-27(15)19-9-5-8-18(23)11-19)22(29)30-14-17-10-20(28)26(13-17)12-16-6-3-2-4-7-16/h2-9,11,17H,10,12-14H2,1H3 |
| InChIKey | AIAMRJCJKHNZSJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |