C17H18BrN3O2 — CID 10068097
tert-butyl (2S,3S)-2-bromo-3-[(3-cyanoindol-1-yl)methyl]aziridine-1-carboxylate (PubChem CID 10068097) has the molecular formula C17H18BrN3O2 and a molecular weight of 376.25 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-bromo-3-[(3-cyanoindol-1-yl)methyl]aziridine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-2-bromo-3-[(3-cyanoindol-1-yl)methyl]aziridine-1-carboxylate |
|---|---|
| PubChem CID | 10068097 |
| Molecular Formula | C17H18BrN3O2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | tert-butyl (2S,3S)-2-bromo-3-[(3-cyanoindol-1-yl)methyl]aziridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](Br)[C@@H]1Cn1cc(C#N)c2ccccc21 |
| InChI | InChI=1S/C17H18BrN3O2/c1-17(2,3)23-16(22)21-14(15(21)18)10-20-9-11(8-19)12-6-4-5-7-13(12)20/h4-7,9,14-15H,10H2,1-3H3/t14-,15+,21?/m0/s1 |
| InChIKey | YNBGUAUKFFDJFN-ZOMUKPOZSA-N |
| XLogP | 3.85 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|