C26H27BrN2O6 — CID 10506694
methyl 1-[[(2S,3S)-3-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]aziridin-2-yl]methyl]-3-formyl-4-phenylmethoxyindole-6-carboxylate (PubChem CID 10506694) has the molecular formula C26H27BrN2O6 and a molecular weight of 543.41 g/mol. Its IUPAC name is methyl 1-[[(2S,3S)-3-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]aziridin-2-yl]methyl]-3-formyl-4-phenylmethoxyindole-6-carboxylate.
| Compound Name | methyl 1-[[(2S,3S)-3-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]aziridin-2-yl]methyl]-3-formyl-4-phenylmethoxyindole-6-carboxylate |
|---|---|
| PubChem CID | 10506694 |
| Molecular Formula | C26H27BrN2O6 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | methyl 1-[[(2S,3S)-3-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]aziridin-2-yl]methyl]-3-formyl-4-phenylmethoxyindole-6-carboxylate |
| SMILES | COC(=O)c1cc(OCc2ccccc2)c2c(C=O)cn(C[C@H]3[C@H](Br)N3C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C26H27BrN2O6/c1-26(2,3)35-25(32)29-20(23(29)27)13-28-12-18(14-30)22-19(28)10-17(24(31)33-4)11-21(22)34-15-16-8-6-5-7-9-16/h5-12,14,20,23H,13,15H2,1-4H3/t20-,23+,29?/m0/s1 |
| InChIKey | RVBQTZMOIWMFSW-KAULRXSXSA-N |
| XLogP | 5.16 |
| TPSA | 86.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|