C31H31N3O7S — CID 10579278
1-O-tert-butyl 2-O-(2-sulfanylidene-1-pyridinyl) (2R,3S)-3-[(6-methoxycarbonyl-4-phenylmethoxyindol-1-yl)methyl]aziridine-1,2-dicarboxylate (PubChem CID 10579278) has the molecular formula C31H31N3O7S and a molecular weight of 589.67 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(2-sulfanylidene-1-pyridinyl) (2R,3S)-3-[(6-methoxycarbonyl-4-phenylmethoxyindol-1-yl)methyl]aziridine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(2-sulfanylidene-1-pyridinyl) (2R,3S)-3-[(6-methoxycarbonyl-4-phenylmethoxyindol-1-yl)methyl]aziridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10579278 |
| Molecular Formula | C31H31N3O7S |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-(2-sulfanylidene-1-pyridinyl) (2R,3S)-3-[(6-methoxycarbonyl-4-phenylmethoxyindol-1-yl)methyl]aziridine-1,2-dicarboxylate |
| SMILES | COC(=O)c1cc(OCc2ccccc2)c2ccn(C[C@H]3[C@H](C(=O)On4ccccc4=S)N3C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C31H31N3O7S/c1-31(2,3)40-30(37)34-24(27(34)29(36)41-33-14-9-8-12-26(33)42)18-32-15-13-22-23(32)16-21(28(35)38-4)17-25(22)39-19-20-10-6-5-7-11-20/h5-17,24,27H,18-19H2,1-4H3/t24-,27+,34?/m0/s1 |
| InChIKey | DWYPMZJUWCJNAN-MSTXKMIESA-N |
| XLogP | 5.18 |
| TPSA | 101.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|