C32H44N2O6Si — CID 10627077
5-O-tert-butyl 12-O-methyl (4S,6R,7R,8R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-phenylmethoxy-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),10,12-triene-5,12-dicarboxylate (PubChem CID 10627077) has the molecular formula C32H44N2O6Si and a molecular weight of 580.80 g/mol. Its IUPAC name is 5-O-tert-butyl 12-O-methyl (4S,6R,7R,8R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-phenylmethoxy-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),10,12-triene-5,12-dicarboxylate.
| Compound Name | 5-O-tert-butyl 12-O-methyl (4S,6R,7R,8R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-phenylmethoxy-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),10,12-triene-5,12-dicarboxylate |
|---|---|
| PubChem CID | 10627077 |
| Molecular Formula | C32H44N2O6Si |
| Molecular Weight | 580.80 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 5-O-tert-butyl 12-O-methyl (4S,6R,7R,8R)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-10-phenylmethoxy-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),10,12-triene-5,12-dicarboxylate |
| SMILES | COC(=O)c1cc(OCc2ccccc2)c2c(c1)N1C[C@H]3[C@@H]([C@H]1[C@@H]2CO[Si](C)(C)C(C)(C)C)N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H44N2O6Si/c1-31(2,3)40-30(36)34-24-17-33-23-15-21(29(35)37-7)16-25(38-18-20-13-11-10-12-14-20)26(23)22(27(33)28(24)34)19-39-41(8,9)32(4,5)6/h10-16,22,24,27-28H,17-19H2,1-9H3/t22-,24+,27-,28+,34?/m1/s1 |
| InChIKey | DCZAMZIFRZXUHM-HEFHZOALSA-N |
| XLogP | 6.35 |
| TPSA | 77.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.80 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|