C36H39Cl2N3O5S — CID 100681721
(2S)-2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100681721) has the molecular formula C36H39Cl2N3O5S and a molecular weight of 696.70 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100681721 |
| Molecular Formula | C36H39Cl2N3O5S |
| Molecular Weight | 696.70 g/mol |
| Exact Mass | 695.20 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-ethoxyanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H39Cl2N3O5S/c1-3-5-22-39-36(43)34(23-27-12-8-6-9-13-27)40(25-28-16-17-29(37)24-33(28)38)35(42)26-41(30-18-20-31(21-19-30)46-4-2)47(44,45)32-14-10-7-11-15-32/h6-21,24,34H,3-5,22-23,25-26H2,1-2H3,(H,39,43)/t34-/m0/s1 |
| InChIKey | SGRQCWLGUKECEF-UMSFTDKQSA-N |
| XLogP | 7.14 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.70 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|