C36H38Cl2FN3O5S — CID 133206859
N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 133206859) has the molecular formula C36H38Cl2FN3O5S and a molecular weight of 714.69 g/mol. Its IUPAC name is N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206859 |
| Molecular Formula | C36H38Cl2FN3O5S |
| Molecular Weight | 714.69 g/mol |
| Exact Mass | 713.19 |
| IUPAC Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(N-(4-ethoxyphenyl)sulfonyl-4-fluoroanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C36H38Cl2FN3O5S/c1-3-5-21-40-36(44)34(22-26-9-7-6-8-10-26)41(24-27-11-12-28(37)23-33(27)38)35(43)25-42(30-15-13-29(39)14-16-30)48(45,46)32-19-17-31(18-20-32)47-4-2/h6-20,23,34H,3-5,21-22,24-25H2,1-2H3,(H,40,44) |
| InChIKey | DWIPQDBCXIIZLV-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.69 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|