C40H39Cl2N3O5S — CID 133206917
2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133206917) has the molecular formula C40H39Cl2N3O5S and a molecular weight of 744.74 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206917 |
| Molecular Formula | C40H39Cl2N3O5S |
| Molecular Weight | 744.74 g/mol |
| Exact Mass | 743.20 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1ccc(Oc2ccccc2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C40H39Cl2N3O5S/c1-2-3-25-43-40(47)38(26-30-13-7-4-8-14-30)44(28-31-19-20-32(41)27-37(31)42)39(46)29-45(51(48,49)36-17-11-6-12-18-36)33-21-23-35(24-22-33)50-34-15-9-5-10-16-34/h4-24,27,38H,2-3,25-26,28-29H2,1H3,(H,43,47) |
| InChIKey | KHEJTGYXWDQLJX-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.74 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|