C37H41Cl2N3O5S2 — CID 100684442
(2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100684442) has the molecular formula C37H41Cl2N3O5S2 and a molecular weight of 742.79 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100684442 |
| Molecular Formula | C37H41Cl2N3O5S2 |
| Molecular Weight | 742.79 g/mol |
| Exact Mass | 741.19 |
| IUPAC Name | (2S)-N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C37H41Cl2N3O5S2/c1-4-6-22-40-37(44)35(23-27-10-8-7-9-11-27)41(25-28-12-13-29(38)24-34(28)39)36(43)26-42(30-14-16-31(17-15-30)47-5-2)49(45,46)33-20-18-32(48-3)19-21-33/h7-21,24,35H,4-6,22-23,25-26H2,1-3H3,(H,40,44)/t35-/m0/s1 |
| InChIKey | LPOMSBTXKAZGLZ-DHUJRADRSA-N |
| XLogP | 7.87 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.79 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|