C20H27NO4S — CID 10068178
(4S,5S)-5-tert-butyl-4-[(4E)-hexa-1,4-dien-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one (PubChem CID 10068178) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is (4S,5S)-5-tert-butyl-4-[(4E)-hexa-1,4-dien-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-5-tert-butyl-4-[(4E)-hexa-1,4-dien-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10068178 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (4S,5S)-5-tert-butyl-4-[(4E)-hexa-1,4-dien-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
| SMILES | C=C(C/C=C/C)[C@H]1[C@H](C(C)(C)C)OC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H27NO4S/c1-7-8-9-15(3)17-18(20(4,5)6)25-19(22)21(17)26(23,24)16-12-10-14(2)11-13-16/h7-8,10-13,17-18H,3,9H2,1-2,4-6H3/b8-7+/t17-,18+/m0/s1 |
| InChIKey | KRYXCDZFYUSHCX-KBSZCIAZSA-N |
| XLogP | 4.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|