C23H20N4O4S — CID 100685529
3-[[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]amino]-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 100685529) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is 3-[[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]amino]-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-[[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]amino]-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 100685529 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 3-[[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]amino]-N-(4-methoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | COc1cccc2sc(NC(=O)c3cccc(NN4C(=O)[C@H]5CC=CC[C@@H]5C4=O)c3)nc12 |
| InChI | InChI=1S/C23H20N4O4S/c1-31-17-10-5-11-18-19(17)24-23(32-18)25-20(28)13-6-4-7-14(12-13)26-27-21(29)15-8-2-3-9-16(15)22(27)30/h2-7,10-12,15-16,26H,8-9H2,1H3,(H,24,25,28)/t15-,16-/m0/s1 |
| InChIKey | ISYXAVFHASVPEE-HOTGVXAUSA-N |
| XLogP | 3.84 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|