C23H27NO3 — CID 100695082
(E)-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 100695082) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is (E)-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 100695082 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (E)-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | CCC1(CC)C[C@@H](NC(=O)/C=C/c2ccccc2OC)c2ccccc2O1 |
| InChI | InChI=1S/C23H27NO3/c1-4-23(5-2)16-19(18-11-7-9-13-21(18)27-23)24-22(25)15-14-17-10-6-8-12-20(17)26-3/h6-15,19H,4-5,16H2,1-3H3,(H,24,25)/b15-14+/t19-/m1/s1 |
| InChIKey | LKCFEUHIKZEXMK-JUWJPQTCSA-N |
| XLogP | 4.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|