C31H30FN5O3S — CID 100698817
3-[3-[(4R,5R)-3-[3-(2-fluoroanilino)-3-oxopropyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoic acid (PubChem CID 100698817) has the molecular formula C31H30FN5O3S and a molecular weight of 571.68 g/mol. Its IUPAC name is 3-[3-[(4R,5R)-3-[3-(2-fluoroanilino)-3-oxopropyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoic acid.
| Compound Name | 3-[3-[(4R,5R)-3-[3-(2-fluoroanilino)-3-oxopropyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 100698817 |
| Molecular Formula | C31H30FN5O3S |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 3-[3-[(4R,5R)-3-[3-(2-fluoroanilino)-3-oxopropyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-n1c(C)cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2CCC(=O)Nc2ccccc2F)c1C |
| InChI | InChI=1S/C31H30FN5O3S/c1-18-11-12-21(30(39)40)17-26(18)37-19(2)16-22(20(37)3)29-28(25-10-6-7-14-33-25)35-31(41)36(29)15-13-27(38)34-24-9-5-4-8-23(24)32/h4-12,14,16-17,28-29H,13,15H2,1-3H3,(H,34,38)(H,35,41)(H,39,40)/t28-,29+/m0/s1 |
| InChIKey | IFCUHWOOVSZMIV-URLMMPGGSA-N |
| XLogP | 5.64 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|