C19H24N4O4 — CID 100699306
(4aS,7aS)-1-(5-nitro-2-piperidin-1-ylbenzoyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 100699306) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is (4aS,7aS)-1-(5-nitro-2-piperidin-1-ylbenzoyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (4aS,7aS)-1-(5-nitro-2-piperidin-1-ylbenzoyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 100699306 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (4aS,7aS)-1-(5-nitro-2-piperidin-1-ylbenzoyl)-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NC[C@@H]2[C@@H]1CCCN2C(=O)c1cc([N+](=O)[O-])ccc1N1CCCCC1 |
| InChI | InChI=1S/C19H24N4O4/c24-18-14-5-4-10-22(17(14)12-20-18)19(25)15-11-13(23(26)27)6-7-16(15)21-8-2-1-3-9-21/h6-7,11,14,17H,1-5,8-10,12H2,(H,20,24)/t14-,17+/m0/s1 |
| InChIKey | LLOOOEJNRZRHFB-WMLDXEAASA-N |
| XLogP | 1.94 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|