C20H28N4O5S — CID 99794658
3-[(4aR,7aR)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl]-N,N-dimethyl-4-morpholin-4-ylbenzenesulfonamide (PubChem CID 99794658) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is 3-[(4aR,7aR)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl]-N,N-dimethyl-4-morpholin-4-ylbenzenesulfonamide.
| Compound Name | 3-[(4aR,7aR)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl]-N,N-dimethyl-4-morpholin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 99794658 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 3-[(4aR,7aR)-5-oxo-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carbonyl]-N,N-dimethyl-4-morpholin-4-ylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)N2CCC[C@H]3C(=O)NC[C@@H]32)c1 |
| InChI | InChI=1S/C20H28N4O5S/c1-22(2)30(27,28)14-5-6-17(23-8-10-29-11-9-23)16(12-14)20(26)24-7-3-4-15-18(24)13-21-19(15)25/h5-6,12,15,18H,3-4,7-11,13H2,1-2H3,(H,21,25)/t15-,18+/m1/s1 |
| InChIKey | TUIFBISUSSBDFJ-QAPCUYQASA-N |
| XLogP | 0.12 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |