C12H21N3O3 — CID 100700120
N-[(2S)-2-cyclohexyl-2-hydroxyethyl]-2-oxoimidazolidine-1-carboxamide (PubChem CID 100700120) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[(2S)-2-cyclohexyl-2-hydroxyethyl]-2-oxoimidazolidine-1-carboxamide.
| Compound Name | N-[(2S)-2-cyclohexyl-2-hydroxyethyl]-2-oxoimidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 100700120 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-[(2S)-2-cyclohexyl-2-hydroxyethyl]-2-oxoimidazolidine-1-carboxamide |
| SMILES | O=C1NCCN1C(=O)NC[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C12H21N3O3/c16-10(9-4-2-1-3-5-9)8-14-12(18)15-7-6-13-11(15)17/h9-10,16H,1-8H2,(H,13,17)(H,14,18)/t10-/m1/s1 |
| InChIKey | WZTUXWMWDPZSEI-SNVBAGLBSA-N |
| XLogP | 0.66 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |