C18H17F2N3OS — CID 100710031
1-(2,6-difluorophenyl)-3-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]thiourea (PubChem CID 100710031) has the molecular formula C18H17F2N3OS and a molecular weight of 361.42 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]thiourea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 100710031 |
| Molecular Formula | C18H17F2N3OS |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]thiourea |
| SMILES | O=C1CCCN1c1cccc(CNC(=S)Nc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C18H17F2N3OS/c19-14-6-2-7-15(20)17(14)22-18(25)21-11-12-4-1-5-13(10-12)23-9-3-8-16(23)24/h1-2,4-7,10H,3,8-9,11H2,(H2,21,22,25) |
| InChIKey | PPIBWNQKFCDOOS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|