C28H31N3O — CID 10071079
2-methyl-N-[3-[3-(2-phenylpropan-2-ylamino)propoxy]phenyl]quinolin-4-amine (PubChem CID 10071079) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is 2-methyl-N-[3-[3-(2-phenylpropan-2-ylamino)propoxy]phenyl]quinolin-4-amine.
| Compound Name | 2-methyl-N-[3-[3-(2-phenylpropan-2-ylamino)propoxy]phenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 10071079 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 2-methyl-N-[3-[3-(2-phenylpropan-2-ylamino)propoxy]phenyl]quinolin-4-amine |
| SMILES | Cc1cc(Nc2cccc(OCCCNC(C)(C)c3ccccc3)c2)c2ccccc2n1 |
| InChI | InChI=1S/C28H31N3O/c1-21-19-27(25-15-7-8-16-26(25)30-21)31-23-13-9-14-24(20-23)32-18-10-17-29-28(2,3)22-11-5-4-6-12-22/h4-9,11-16,19-20,29H,10,17-18H2,1-3H3,(H,30,31) |
| InChIKey | XJJAAEOYNXFFET-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|