C31H33N3O3 — CID 58958150
4-benzyl-1-[2-[3-[(2-methylquinolin-4-yl)amino]phenoxy]ethyl]piperidine-4-carboxylic acid (PubChem CID 58958150) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 4-benzyl-1-[2-[3-[(2-methylquinolin-4-yl)amino]phenoxy]ethyl]piperidine-4-carboxylic acid.
| Compound Name | 4-benzyl-1-[2-[3-[(2-methylquinolin-4-yl)amino]phenoxy]ethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 58958150 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 4-benzyl-1-[2-[3-[(2-methylquinolin-4-yl)amino]phenoxy]ethyl]piperidine-4-carboxylic acid |
| SMILES | Cc1cc(Nc2cccc(OCCN3CCC(Cc4ccccc4)(C(=O)O)CC3)c2)c2ccccc2n1 |
| InChI | InChI=1S/C31H33N3O3/c1-23-20-29(27-12-5-6-13-28(27)32-23)33-25-10-7-11-26(21-25)37-19-18-34-16-14-31(15-17-34,30(35)36)22-24-8-3-2-4-9-24/h2-13,20-21H,14-19,22H2,1H3,(H,32,33)(H,35,36) |
| InChIKey | SODNYAUPHIJMBW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |