C21H24N6O5S3 — CID 100714608
N-[5-[[4-methyl-3-(4-methylpiperazin-1-yl)sulfonylphenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100714608) has the molecular formula C21H24N6O5S3 and a molecular weight of 536.66 g/mol. Its IUPAC name is N-[5-[[4-methyl-3-(4-methylpiperazin-1-yl)sulfonylphenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-[[4-methyl-3-(4-methylpiperazin-1-yl)sulfonylphenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100714608 |
| Molecular Formula | C21H24N6O5S3 |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | N-[5-[[4-methyl-3-(4-methylpiperazin-1-yl)sulfonylphenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2nnc(NC(=O)c3ccccc3)s2)cc1S(=O)(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C21H24N6O5S3/c1-15-8-9-17(14-18(15)35(31,32)27-12-10-26(2)11-13-27)25-34(29,30)21-24-23-20(33-21)22-19(28)16-6-4-3-5-7-16/h3-9,14,25H,10-13H2,1-2H3,(H,22,23,28) |
| InChIKey | JPCWRGYMCMTFJY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|