C21H28O10 — CID 10071934
(3'E,4S,5R,6S,7S,8S,9S,10R)-5,9,10-trihydroxy-3'-(2-hydroxy-1-methoxyethylidene)-8-methoxy-7-methyl-10-propan-2-ylspiro[3-oxatricyclo[5.3.1.04,11]undec-1(11)-ene-6,5'-oxolane]-2,2'-dione (PubChem CID 10071934) has the molecular formula C21H28O10 and a molecular weight of 440.45 g/mol. Its IUPAC name is (3'E,4S,5R,6S,7S,8S,9S,10R)-5,9,10-trihydroxy-3'-(2-hydroxy-1-methoxyethylidene)-8-methoxy-7-methyl-10-propan-2-ylspiro[3-oxatricyclo[5.3.1.04,11]undec-1(11)-ene-6,5'-oxolane]-2,2'-dione.
| Compound Name | (3'E,4S,5R,6S,7S,8S,9S,10R)-5,9,10-trihydroxy-3'-(2-hydroxy-1-methoxyethylidene)-8-methoxy-7-methyl-10-propan-2-ylspiro[3-oxatricyclo[5.3.1.04,11]undec-1(11)-ene-6,5'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 10071934 |
| Molecular Formula | C21H28O10 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (3'E,4S,5R,6S,7S,8S,9S,10R)-5,9,10-trihydroxy-3'-(2-hydroxy-1-methoxyethylidene)-8-methoxy-7-methyl-10-propan-2-ylspiro[3-oxatricyclo[5.3.1.04,11]undec-1(11)-ene-6,5'-oxolane]-2,2'-dione |
| SMILES | CO/C(CO)=C1\C[C@@]2(OC1=O)[C@H](O)[C@H]1OC(=O)C3=C1[C@@]2(C)[C@H](OC)[C@H](O)[C@@]3(O)C(C)C |
| InChI | InChI=1S/C21H28O10/c1-8(2)21(27)12-11-13(30-18(12)26)14(23)20(19(11,3)16(29-5)15(21)24)6-9(17(25)31-20)10(7-22)28-4/h8,13-16,22-24,27H,6-7H2,1-5H3/b10-9+/t13-,14+,15-,16+,19-,20+,21+/m0/s1 |
| InChIKey | XMAGTDSEMQPGBK-VIEKZOIDSA-N |
| XLogP | -1.06 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|