C15H18O5 — CID 91758437
(1R,2S,9S,15R)-2,7,15-trimethyl-4,8,12-trioxatetracyclo[7.3.3.01,9.02,6]pentadec-6-ene-5,11-dione (PubChem CID 91758437) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (1R,2S,9S,15R)-2,7,15-trimethyl-4,8,12-trioxatetracyclo[7.3.3.01,9.02,6]pentadec-6-ene-5,11-dione.
| Compound Name | (1R,2S,9S,15R)-2,7,15-trimethyl-4,8,12-trioxatetracyclo[7.3.3.01,9.02,6]pentadec-6-ene-5,11-dione |
|---|---|
| PubChem CID | 91758437 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1R,2S,9S,15R)-2,7,15-trimethyl-4,8,12-trioxatetracyclo[7.3.3.01,9.02,6]pentadec-6-ene-5,11-dione |
| SMILES | CC1=C2C(=O)OC[C@@]2(C)[C@]23CC[C@@H](C)[C@]2(CC(=O)O3)O1 |
| InChI | InChI=1S/C15H18O5/c1-8-4-5-15-13(3)7-18-12(17)11(13)9(2)19-14(8,15)6-10(16)20-15/h8H,4-7H2,1-3H3/t8-,13-,14+,15-/m1/s1 |
| InChIKey | CCVORUWVTGPVCI-LWFJWFQOSA-N |
| XLogP | 1.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |