C19H23NO4S — CID 100719949
methyl 3-[(2,5-diethylphenyl)methylsulfamoyl]benzoate (PubChem CID 100719949) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is methyl 3-[(2,5-diethylphenyl)methylsulfamoyl]benzoate.
| Compound Name | methyl 3-[(2,5-diethylphenyl)methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 100719949 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | methyl 3-[(2,5-diethylphenyl)methylsulfamoyl]benzoate |
| SMILES | CCc1ccc(CC)c(CNS(=O)(=O)c2cccc(C(=O)OC)c2)c1 |
| InChI | InChI=1S/C19H23NO4S/c1-4-14-9-10-15(5-2)17(11-14)13-20-25(22,23)18-8-6-7-16(12-18)19(21)24-3/h6-12,20H,4-5,13H2,1-3H3 |
| InChIKey | CGCPZRHDDLBSSJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |