C14H14FNO4S — CID 100722173
(3S,5R)-5-(3-fluorophenyl)-1-(furan-2-ylsulfonyl)pyrrolidin-3-ol (PubChem CID 100722173) has the molecular formula C14H14FNO4S and a molecular weight of 311.33 g/mol. Its IUPAC name is (3S,5R)-5-(3-fluorophenyl)-1-(furan-2-ylsulfonyl)pyrrolidin-3-ol.
| Compound Name | (3S,5R)-5-(3-fluorophenyl)-1-(furan-2-ylsulfonyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 100722173 |
| Molecular Formula | C14H14FNO4S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (3S,5R)-5-(3-fluorophenyl)-1-(furan-2-ylsulfonyl)pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccco1)N1C[C@@H](O)C[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C14H14FNO4S/c15-11-4-1-3-10(7-11)13-8-12(17)9-16(13)21(18,19)14-5-2-6-20-14/h1-7,12-13,17H,8-9H2/t12-,13+/m0/s1 |
| InChIKey | LGPXYJBGAFDTOP-QWHCGFSZSA-N |
| XLogP | 1.92 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |