C16H18FNO4S — CID 128963851
1-(2,5-dimethylfuran-3-yl)sulfonyl-5-(4-fluorophenyl)pyrrolidin-3-ol (PubChem CID 128963851) has the molecular formula C16H18FNO4S and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-(2,5-dimethylfuran-3-yl)sulfonyl-5-(4-fluorophenyl)pyrrolidin-3-ol.
| Compound Name | 1-(2,5-dimethylfuran-3-yl)sulfonyl-5-(4-fluorophenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 128963851 |
| Molecular Formula | C16H18FNO4S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-(2,5-dimethylfuran-3-yl)sulfonyl-5-(4-fluorophenyl)pyrrolidin-3-ol |
| SMILES | Cc1cc(S(=O)(=O)N2CC(O)CC2c2ccc(F)cc2)c(C)o1 |
| InChI | InChI=1S/C16H18FNO4S/c1-10-7-16(11(2)22-10)23(20,21)18-9-14(19)8-15(18)12-3-5-13(17)6-4-12/h3-7,14-15,19H,8-9H2,1-2H3 |
| InChIKey | DRESCQGCRMLAHT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |