C14H13F2NO4S — CID 129429883
(3R,5S)-5-(2,5-difluorophenyl)-1-(furan-2-ylsulfonyl)pyrrolidin-3-ol (PubChem CID 129429883) has the molecular formula C14H13F2NO4S and a molecular weight of 329.32 g/mol. Its IUPAC name is (3R,5S)-5-(2,5-difluorophenyl)-1-(furan-2-ylsulfonyl)pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-(2,5-difluorophenyl)-1-(furan-2-ylsulfonyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129429883 |
| Molecular Formula | C14H13F2NO4S |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (3R,5S)-5-(2,5-difluorophenyl)-1-(furan-2-ylsulfonyl)pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccco1)N1C[C@H](O)C[C@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C14H13F2NO4S/c15-9-3-4-12(16)11(6-9)13-7-10(18)8-17(13)22(19,20)14-2-1-5-21-14/h1-6,10,13,18H,7-8H2/t10-,13+/m1/s1 |
| InChIKey | GIRCZTNMNARBQC-MFKMUULPSA-N |
| XLogP | 2.05 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |