C24H18Cl2N4O — CID 10072388
3-(2-anilinopyrimidin-4-yl)-N-[(2,3-dichlorophenyl)methyl]benzamide (PubChem CID 10072388) has the molecular formula C24H18Cl2N4O and a molecular weight of 449.34 g/mol. Its IUPAC name is 3-(2-anilinopyrimidin-4-yl)-N-[(2,3-dichlorophenyl)methyl]benzamide.
| Compound Name | 3-(2-anilinopyrimidin-4-yl)-N-[(2,3-dichlorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 10072388 |
| Molecular Formula | C24H18Cl2N4O |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 3-(2-anilinopyrimidin-4-yl)-N-[(2,3-dichlorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1cccc(Cl)c1Cl)c1cccc(-c2ccnc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H18Cl2N4O/c25-20-11-5-8-18(22(20)26)15-28-23(31)17-7-4-6-16(14-17)21-12-13-27-24(30-21)29-19-9-2-1-3-10-19/h1-14H,15H2,(H,28,31)(H,27,29,30) |
| InChIKey | UFXIZNSLLVOYBR-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |