C24H17ClN6O — CID 130204632
2-(2-chlorophenyl)-N-[2-cyano-4-[2-(pyridin-4-ylamino)pyrimidin-4-yl]phenyl]acetamide (PubChem CID 130204632) has the molecular formula C24H17ClN6O and a molecular weight of 440.89 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[2-cyano-4-[2-(pyridin-4-ylamino)pyrimidin-4-yl]phenyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[2-cyano-4-[2-(pyridin-4-ylamino)pyrimidin-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 130204632 |
| Molecular Formula | C24H17ClN6O |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[2-cyano-4-[2-(pyridin-4-ylamino)pyrimidin-4-yl]phenyl]acetamide |
| SMILES | N#Cc1cc(-c2ccnc(Nc3ccncc3)n2)ccc1NC(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C24H17ClN6O/c25-20-4-2-1-3-16(20)14-23(32)30-21-6-5-17(13-18(21)15-26)22-9-12-28-24(31-22)29-19-7-10-27-11-8-19/h1-13H,14H2,(H,30,32)(H,27,28,29,31) |
| InChIKey | RQOPWGZHRHAJDZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |