About (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide
(2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide (PubChem CID 100727293) has the molecular formula C18H25FN4O2
and a molecular weight of 348.42 g/mol. Its IUPAC name is (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide.
Molecular Properties
| Compound Name | (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide |
| PubChem CID | 100727293 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide |
| SMILES | Cc1ccc2c(CCNC(=O)N[C@H](C)C(=O)NCCF)cn(C)c2c1 |
| InChI | InChI=1S/C18H25FN4O2/c1-12-4-5-15-14(11-23(3)16(15)10-12)6-8-21-18(25)22-13(2)17(24)20-9-7-19/h4-5,10-11,13H,6-9H2,1-3H3,(H,20,24)(H2,21,22,25)/t13-/m1/s1 |
| InChIKey | HBXRUGQAQPBGIL-CYBMUJFWSA-N |
| XLogP | 1.80 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide?
The IUPAC name of (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide (CID 100727293) is (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide.
What is the SMILES notation for (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide?
The canonical SMILES for (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide is Cc1ccc2c(CCNC(=O)N[C@H](C)C(=O)NCCF)cn(C)c2c1.
What is the InChIKey of (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide?
The InChIKey is HBXRUGQAQPBGIL-CYBMUJFWSA-N. The full InChI is InChI=1S/C18H25FN4O2/c1-12-4-5-15-14(11-23(3)16(15)10-12)6-8-21-18(25)22-13(2)17(24)20-9-7-19/h4-5,10-11,13H,6-9H2,1-3H3,(H,20,24)(H2,21,22,25)/t13-/m1/s1.
What are the key properties of (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide?
(2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide has a molecular weight of 348.42 g/mol, XLogP of 1.80, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[2-(1,6-dimethylindol-3-yl)ethylcarbamoylamino]-N-(2-fluoroethyl)propanamide is sourced from PubChem (CID 100727293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).