C23H30N6O3Si — CID 10073238
[(4R,5R)-4,5-bis(azidomethyl)-2-methyl-1,3-dioxolan-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 10073238) has the molecular formula C23H30N6O3Si and a molecular weight of 466.62 g/mol. Its IUPAC name is [(4R,5R)-4,5-bis(azidomethyl)-2-methyl-1,3-dioxolan-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(4R,5R)-4,5-bis(azidomethyl)-2-methyl-1,3-dioxolan-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10073238 |
| Molecular Formula | C23H30N6O3Si |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [(4R,5R)-4,5-bis(azidomethyl)-2-methyl-1,3-dioxolan-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H](CN=[N+]=[N-])[C@@H](CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C23H30N6O3Si/c1-22(2,3)33(18-11-7-5-8-12-18,19-13-9-6-10-14-19)30-17-23(4)31-20(15-26-28-24)21(32-23)16-27-29-25/h5-14,20-21H,15-17H2,1-4H3/t20-,21-/m1/s1 |
| InChIKey | SHHBKDPAVVWRFA-NHCUHLMSSA-N |
| XLogP | 4.68 |
| TPSA | 125.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|