C20H25N3O3Si — CID 10738752
(3S,4R)-4-azido-2-[tert-butyl(diphenyl)silyl]oxyoxolan-3-ol (PubChem CID 10738752) has the molecular formula C20H25N3O3Si and a molecular weight of 383.52 g/mol. Its IUPAC name is (3S,4R)-4-azido-2-[tert-butyl(diphenyl)silyl]oxyoxolan-3-ol.
| Compound Name | (3S,4R)-4-azido-2-[tert-butyl(diphenyl)silyl]oxyoxolan-3-ol |
|---|---|
| PubChem CID | 10738752 |
| Molecular Formula | C20H25N3O3Si |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (3S,4R)-4-azido-2-[tert-butyl(diphenyl)silyl]oxyoxolan-3-ol |
| SMILES | CC(C)(C)[Si](OC1OC[C@@H](N=[N+]=[N-])[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O3Si/c1-20(2,3)27(15-10-6-4-7-11-15,16-12-8-5-9-13-16)26-19-18(24)17(14-25-19)22-23-21/h4-13,17-19,24H,14H2,1-3H3/t17-,18+,19?/m1/s1 |
| InChIKey | IOOLWXYQNADRMG-YTYFACEESA-N |
| XLogP | 2.96 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|