C21H27N3O3Si — CID 10363440
(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-ol (PubChem CID 10363440) has the molecular formula C21H27N3O3Si and a molecular weight of 397.55 g/mol. Its IUPAC name is (4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-ol.
| Compound Name | (4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-ol |
|---|---|
| PubChem CID | 10363440 |
| Molecular Formula | C21H27N3O3Si |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC(O)C[C@@H]1N=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O3Si/c1-21(2,3)28(16-10-6-4-7-11-16,17-12-8-5-9-13-17)26-15-19-18(23-24-22)14-20(25)27-19/h4-13,18-20,25H,14-15H2,1-3H3/t18-,19+,20?/m0/s1 |
| InChIKey | ITMARJXVQJASMZ-ABZYKWASSA-N |
| XLogP | 3.35 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|