C30H33FN2O4 — CID 10074862
N-(4-fluorophenyl)-N-[1-(4-hydroxy-4-phenyloxan-3-yl)piperidin-4-yl]-3-methoxybenzamide (PubChem CID 10074862) has the molecular formula C30H33FN2O4 and a molecular weight of 504.60 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-[1-(4-hydroxy-4-phenyloxan-3-yl)piperidin-4-yl]-3-methoxybenzamide.
| Compound Name | N-(4-fluorophenyl)-N-[1-(4-hydroxy-4-phenyloxan-3-yl)piperidin-4-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 10074862 |
| Molecular Formula | C30H33FN2O4 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | N-(4-fluorophenyl)-N-[1-(4-hydroxy-4-phenyloxan-3-yl)piperidin-4-yl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N(c2ccc(F)cc2)C2CCN(C3COCCC3(O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C30H33FN2O4/c1-36-27-9-5-6-22(20-27)29(34)33(25-12-10-24(31)11-13-25)26-14-17-32(18-15-26)28-21-37-19-16-30(28,35)23-7-3-2-4-8-23/h2-13,20,26,28,35H,14-19,21H2,1H3 |
| InChIKey | QLCZXAXHEMFUMY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |