C21H24ClNO12 — CID 10075279
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-(chloromethyl)-6-nitrophenoxy]oxan-2-yl]methyl acetate (PubChem CID 10075279) has the molecular formula C21H24ClNO12 and a molecular weight of 517.87 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-(chloromethyl)-6-nitrophenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-(chloromethyl)-6-nitrophenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10075279 |
| Molecular Formula | C21H24ClNO12 |
| Molecular Weight | 517.87 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-(chloromethyl)-6-nitrophenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Oc2c(CCl)cccc2[N+](=O)[O-])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H24ClNO12/c1-10(24)30-9-16-18(31-11(2)25)19(32-12(3)26)20(33-13(4)27)21(34-16)35-17-14(8-22)6-5-7-15(17)23(28)29/h5-7,16,18-21H,8-9H2,1-4H3/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | GHUBDGXBVZTLMS-QNDFHXLGSA-N |
| XLogP | 1.80 |
| TPSA | 166.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.87 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|