C25H24ClFN2O5S — CID 100755569
N-[(Z)-3-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethoxybenzamide (PubChem CID 100755569) has the molecular formula C25H24ClFN2O5S and a molecular weight of 518.99 g/mol. Its IUPAC name is N-[(Z)-3-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(Z)-3-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 100755569 |
| Molecular Formula | C25H24ClFN2O5S |
| Molecular Weight | 518.99 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | N-[(Z)-3-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-1-(furan-2-yl)-3-oxoprop-1-en-2-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=C\c2ccco2)C(=O)NCCSCc2c(F)cccc2Cl)cc1OC |
| InChI | InChI=1S/C25H24ClFN2O5S/c1-32-22-9-8-16(13-23(22)33-2)24(30)29-21(14-17-5-4-11-34-17)25(31)28-10-12-35-15-18-19(26)6-3-7-20(18)27/h3-9,11,13-14H,10,12,15H2,1-2H3,(H,28,31)(H,29,30)/b21-14- |
| InChIKey | LDXINZRXBIDCNK-STZFKDTASA-N |
| XLogP | 4.91 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.99 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|