C23H20ClFN2O2S2 — CID 100567999
N-[(Z)-3-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 100567999) has the molecular formula C23H20ClFN2O2S2 and a molecular weight of 475.01 g/mol. Its IUPAC name is N-[(Z)-3-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 100567999 |
| Molecular Formula | C23H20ClFN2O2S2 |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | N-[(Z)-3-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethylamino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(NCCSCc1c(F)cccc1Cl)/C(=C/c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20ClFN2O2S2/c24-19-9-4-10-20(25)18(19)15-30-13-11-26-23(29)21(14-17-8-5-12-31-17)27-22(28)16-6-2-1-3-7-16/h1-10,12,14H,11,13,15H2,(H,26,29)(H,27,28)/b21-14- |
| InChIKey | LKJJLQRRQWLVMZ-STZFKDTASA-N |
| XLogP | 5.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|