C28H35F3N6O — CID 10075634
2,6-bis[(4-methylpiperazin-1-yl)methyl]-4-[[7-(trifluoromethyl)quinolin-3-yl]amino]phenol (PubChem CID 10075634) has the molecular formula C28H35F3N6O and a molecular weight of 528.62 g/mol. Its IUPAC name is 2,6-bis[(4-methylpiperazin-1-yl)methyl]-4-[[7-(trifluoromethyl)quinolin-3-yl]amino]phenol.
| Compound Name | 2,6-bis[(4-methylpiperazin-1-yl)methyl]-4-[[7-(trifluoromethyl)quinolin-3-yl]amino]phenol |
|---|---|
| PubChem CID | 10075634 |
| Molecular Formula | C28H35F3N6O |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 2,6-bis[(4-methylpiperazin-1-yl)methyl]-4-[[7-(trifluoromethyl)quinolin-3-yl]amino]phenol |
| SMILES | CN1CCN(Cc2cc(Nc3cnc4cc(C(F)(F)F)ccc4c3)cc(CN3CCN(C)CC3)c2O)CC1 |
| InChI | InChI=1S/C28H35F3N6O/c1-34-5-9-36(10-6-34)18-21-14-24(15-22(27(21)38)19-37-11-7-35(2)8-12-37)33-25-13-20-3-4-23(28(29,30)31)16-26(20)32-17-25/h3-4,13-17,33,38H,5-12,18-19H2,1-2H3 |
| InChIKey | AUPXJPWEWVYQCX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|