C21H17Br2NO3S2 — CID 10076359
N-[2-(2-bromophenyl)sulfanyl-5-[(2-bromophenyl)sulfanylmethoxy]-4-hydroxyphenyl]acetamide (PubChem CID 10076359) has the molecular formula C21H17Br2NO3S2 and a molecular weight of 555.31 g/mol. Its IUPAC name is N-[2-(2-bromophenyl)sulfanyl-5-[(2-bromophenyl)sulfanylmethoxy]-4-hydroxyphenyl]acetamide.
| Compound Name | N-[2-(2-bromophenyl)sulfanyl-5-[(2-bromophenyl)sulfanylmethoxy]-4-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 10076359 |
| Molecular Formula | C21H17Br2NO3S2 |
| Molecular Weight | 555.31 g/mol |
| Exact Mass | 552.90 |
| IUPAC Name | N-[2-(2-bromophenyl)sulfanyl-5-[(2-bromophenyl)sulfanylmethoxy]-4-hydroxyphenyl]acetamide |
| SMILES | CC(=O)Nc1cc(OCSc2ccccc2Br)c(O)cc1Sc1ccccc1Br |
| InChI | InChI=1S/C21H17Br2NO3S2/c1-13(25)24-16-10-18(27-12-28-19-8-4-2-6-14(19)22)17(26)11-21(16)29-20-9-5-3-7-15(20)23/h2-11,26H,12H2,1H3,(H,24,25) |
| InChIKey | XKZOJBZAGKLUOF-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.31 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|