C22H26ClN3O3S — CID 100764247
ethyl 2-chloro-4-[[(1R)-1-(4-morpholin-4-ylphenyl)ethyl]carbamothioylamino]benzoate (PubChem CID 100764247) has the molecular formula C22H26ClN3O3S and a molecular weight of 447.99 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[(1R)-1-(4-morpholin-4-ylphenyl)ethyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 2-chloro-4-[[(1R)-1-(4-morpholin-4-ylphenyl)ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100764247 |
| Molecular Formula | C22H26ClN3O3S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | ethyl 2-chloro-4-[[(1R)-1-(4-morpholin-4-ylphenyl)ethyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N[C@H](C)c2ccc(N3CCOCC3)cc2)cc1Cl |
| InChI | InChI=1S/C22H26ClN3O3S/c1-3-29-21(27)19-9-6-17(14-20(19)23)25-22(30)24-15(2)16-4-7-18(8-5-16)26-10-12-28-13-11-26/h4-9,14-15H,3,10-13H2,1-2H3,(H2,24,25,30)/t15-/m1/s1 |
| InChIKey | ZLSLPVFBMXRIQL-OAHLLOKOSA-N |
| XLogP | 4.40 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|