C35H67NO5Si2 — CID 10077853
[(3Z,5S,6S,7R,8R,9S,11Z,13S,14R,15R)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-16-oxohexadeca-1,3,11-trien-6-yl] carbamate (PubChem CID 10077853) has the molecular formula C35H67NO5Si2 and a molecular weight of 638.10 g/mol. Its IUPAC name is [(3Z,5S,6S,7R,8R,9S,11Z,13S,14R,15R)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-16-oxohexadeca-1,3,11-trien-6-yl] carbamate.
| Compound Name | [(3Z,5S,6S,7R,8R,9S,11Z,13S,14R,15R)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-16-oxohexadeca-1,3,11-trien-6-yl] carbamate |
|---|---|
| PubChem CID | 10077853 |
| Molecular Formula | C35H67NO5Si2 |
| Molecular Weight | 638.10 g/mol |
| Exact Mass | 637.46 |
| IUPAC Name | [(3Z,5S,6S,7R,8R,9S,11Z,13S,14R,15R)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-16-oxohexadeca-1,3,11-trien-6-yl] carbamate |
| SMILES | C=C/C=C\[C@H](C)[C@H](OC(N)=O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C35H67NO5Si2/c1-18-19-20-25(3)31(39-33(36)38)29(7)32(41-43(16,17)35(11,12)13)27(5)22-24(2)21-26(4)30(28(6)23-37)40-42(14,15)34(8,9)10/h18-21,23,25-32H,1,22H2,2-17H3,(H2,36,38)/b20-19-,24-21-/t25-,26-,27-,28-,29+,30+,31-,32+/m0/s1 |
| InChIKey | PNEPBXIPVTYJHU-JUZMYCFCSA-N |
| XLogP | 9.69 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.10 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|