C14H24N4O5S2 — CID 100784878
2-[dimethylsulfamoyl(methyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 100784878) has the molecular formula C14H24N4O5S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[dimethylsulfamoyl(methyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-[dimethylsulfamoyl(methyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 100784878 |
| Molecular Formula | C14H24N4O5S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[dimethylsulfamoyl(methyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)CN(C)S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C14H24N4O5S2/c1-12-5-7-13(8-6-12)24(20,21)16-10-9-15-14(19)11-18(4)25(22,23)17(2)3/h5-8,16H,9-11H2,1-4H3,(H,15,19) |
| InChIKey | IEEGVHYCNMTTNZ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|