C20H27N3O5S2 — CID 100780815
2-[(2,5-dimethylphenyl)sulfonyl-methylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 100780815) has the molecular formula C20H27N3O5S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)sulfonyl-methylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-[(2,5-dimethylphenyl)sulfonyl-methylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 100780815 |
| Molecular Formula | C20H27N3O5S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)sulfonyl-methylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)CN(C)S(=O)(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C20H27N3O5S2/c1-15-6-9-18(10-7-15)29(25,26)22-12-11-21-20(24)14-23(4)30(27,28)19-13-16(2)5-8-17(19)3/h5-10,13,22H,11-12,14H2,1-4H3,(H,21,24) |
| InChIKey | TXDANWDBVMNRLW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|